C18H23N3O6 — CID 7832955
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)acetate (PubChem CID 7832955) has the molecular formula C18H23N3O6 and a molecular weight of 377.40 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)acetate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 7832955 |
| Molecular Formula | C18H23N3O6 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-nitrophenyl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1ccccc1[N+](=O)[O-])C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H23N3O6/c1-12(17(23)20-18(24)19-14-8-3-2-4-9-14)27-16(22)11-13-7-5-6-10-15(13)21(25)26/h5-7,10,12,14H,2-4,8-9,11H2,1H3,(H2,19,20,23,24)/t12-/m1/s1 |
| InChIKey | KZNADVGDVKIXNC-GFCCVEGCSA-N |
| XLogP | 2.23 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|