C18H22ClFN2O4 — CID 7718286
[(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate (PubChem CID 7718286) has the molecular formula C18H22ClFN2O4 and a molecular weight of 384.84 g/mol. Its IUPAC name is [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate.
| Compound Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
|---|---|
| PubChem CID | 7718286 |
| Molecular Formula | C18H22ClFN2O4 |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | [(2S)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 2-(2-chloro-6-fluorophenyl)acetate |
| SMILES | C[C@H](OC(=O)Cc1c(F)cccc1Cl)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H22ClFN2O4/c1-11(17(24)22-18(25)21-12-6-3-2-4-7-12)26-16(23)10-13-14(19)8-5-9-15(13)20/h5,8-9,11-12H,2-4,6-7,10H2,1H3,(H2,21,22,24,25)/t11-/m0/s1 |
| InChIKey | STLOISYGZCMRHM-NSHDSACASA-N |
| XLogP | 3.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |