C18H24N2O4 — CID 9063212
[(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate (PubChem CID 9063212) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate.
| Compound Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate |
|---|---|
| PubChem CID | 9063212 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [(2R)-1-(cyclopentylcarbamoylamino)-1-oxopropan-2-yl] 2-(4-methylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)O[C@H](C)C(=O)NC(=O)NC2CCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c1-12-7-9-14(10-8-12)11-16(21)24-13(2)17(22)20-18(23)19-15-5-3-4-6-15/h7-10,13,15H,3-6,11H2,1-2H3,(H2,19,20,22,23)/t13-/m1/s1 |
| InChIKey | CPWIDBQEEJGBGS-CYBMUJFWSA-N |
| XLogP | 2.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |