C17H22FNO3 — CID 40722371
[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)acetate (PubChem CID 40722371) has the molecular formula C17H22FNO3 and a molecular weight of 307.36 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)acetate.
| Compound Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 40722371 |
| Molecular Formula | C17H22FNO3 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | [(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl] 2-(4-fluorophenyl)acetate |
| SMILES | C[C@@H](OC(=O)Cc1ccc(F)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H22FNO3/c1-12(17(21)19-15-5-3-2-4-6-15)22-16(20)11-13-7-9-14(18)10-8-13/h7-10,12,15H,2-6,11H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | PXGCWSYDWWRDDH-GFCCVEGCSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |