C19H25FN2O4 — CID 8553461
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate (PubChem CID 8553461) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8553461 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(4-fluorophenyl)propanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccc(F)cc1)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H25FN2O4/c1-13(18(24)22-19(25)21-16-5-3-2-4-6-16)26-17(23)12-9-14-7-10-15(20)11-8-14/h7-8,10-11,13,16H,2-6,9,12H2,1H3,(H2,21,22,24,25)/t13-/m1/s1 |
| InChIKey | HLNJXNRGAURBPH-CYBMUJFWSA-N |
| XLogP | 2.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |