C20H28N2O5 — CID 40692975
[(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(2-methoxyphenyl)propanoate (PubChem CID 40692975) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(2-methoxyphenyl)propanoate.
| Compound Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(2-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 40692975 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [(2R)-1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] 3-(2-methoxyphenyl)propanoate |
| SMILES | COc1ccccc1CCC(=O)O[C@H](C)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H28N2O5/c1-14(19(24)22-20(25)21-16-9-4-3-5-10-16)27-18(23)13-12-15-8-6-7-11-17(15)26-2/h6-8,11,14,16H,3-5,9-10,12-13H2,1-2H3,(H2,21,22,24,25)/t14-/m1/s1 |
| InChIKey | YRFLXSSBXOLLFF-CQSZACIVSA-N |
| XLogP | 2.72 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |