C19H26FNO3 — CID 9384132
[(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(2-fluorophenyl)propanoate (PubChem CID 9384132) has the molecular formula C19H26FNO3 and a molecular weight of 335.42 g/mol. Its IUPAC name is [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(2-fluorophenyl)propanoate.
| Compound Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 9384132 |
| Molecular Formula | C19H26FNO3 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(2-fluorophenyl)propanoate |
| SMILES | C[C@H](OC(=O)CCc1ccccc1F)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H26FNO3/c1-14(19(23)21-16-9-4-2-3-5-10-16)24-18(22)13-12-15-8-6-7-11-17(15)20/h6-8,11,14,16H,2-5,9-10,12-13H2,1H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | WXGQDTVKQJUUMP-AWEZNQCLSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |