C19H28N2O5S — CID 8880051
[(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate (PubChem CID 8880051) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate.
| Compound Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 8880051 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [(2R)-1-(cycloheptylamino)-1-oxopropan-2-yl] 3-(benzenesulfonamido)propanoate |
| SMILES | C[C@@H](OC(=O)CCNS(=O)(=O)c1ccccc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H28N2O5S/c1-15(19(23)21-16-9-5-2-3-6-10-16)26-18(22)13-14-20-27(24,25)17-11-7-4-8-12-17/h4,7-8,11-12,15-16,20H,2-3,5-6,9-10,13-14H2,1H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | NLGJGASRNUTHEG-OAHLLOKOSA-N |
| XLogP | 2.13 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |