C19H22N2O5S — CID 7414454
[(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7414454) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7414454 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(2R)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | C[C@@H](OC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H22N2O5S/c1-13(19(23)21-16-7-8-16)26-18(22)10-11-20-27(24,25)17-9-6-14-4-2-3-5-15(14)12-17/h2-6,9,12-13,16,20H,7-8,10-11H2,1H3,(H,21,23)/t13-/m1/s1 |
| InChIKey | QFSKUSBEDHKARQ-CYBMUJFWSA-N |
| XLogP | 1.72 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |