C16H17NO6S — CID 16624451
(2-methoxy-2-oxoethyl) 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 16624451) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | (2-methoxy-2-oxoethyl) 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 16624451 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | COC(=O)COC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17NO6S/c1-22-16(19)11-23-15(18)8-9-17-24(20,21)14-7-6-12-4-2-3-5-13(12)10-14/h2-7,10,17H,8-9,11H2,1H3 |
| InChIKey | HHAXWFNAMNPMMJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |