C21H18FNO5S — CID 8676628
[2-(3-fluorophenyl)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 8676628) has the molecular formula C21H18FNO5S and a molecular weight of 415.44 g/mol. Its IUPAC name is [2-(3-fluorophenyl)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 8676628 |
| Molecular Formula | C21H18FNO5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | [2-(3-fluorophenyl)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)OCC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H18FNO5S/c22-18-7-3-6-17(12-18)20(24)14-28-21(25)10-11-23-29(26,27)19-9-8-15-4-1-2-5-16(15)13-19/h1-9,12-13,23H,10-11,14H2 |
| InChIKey | ICHDRQUXTQRCBX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |