C25H26N2O6S — CID 16556432
[2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 16556432) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 16556432 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | [2-[4-(butanoylamino)phenyl]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | CCCC(=O)Nc1ccc(C(=O)COC(=O)CCNS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C25H26N2O6S/c1-2-5-24(29)27-21-11-8-19(9-12-21)23(28)17-33-25(30)14-15-26-34(31,32)22-13-10-18-6-3-4-7-20(18)16-22/h3-4,6-13,16,26H,2,5,14-15,17H2,1H3,(H,27,29) |
| InChIKey | FMIWHRZMGWRXBE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |