C23H25N3O4S — CID 55948759
4-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]-N-propylbenzamide (PubChem CID 55948759) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]-N-propylbenzamide.
| Compound Name | 4-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 55948759 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-[3-(naphthalen-2-ylsulfonylamino)propanoylamino]-N-propylbenzamide |
| SMILES | CCCNC(=O)c1ccc(NC(=O)CCNS(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H25N3O4S/c1-2-14-24-23(28)18-7-10-20(11-8-18)26-22(27)13-15-25-31(29,30)21-12-9-17-5-3-4-6-19(17)16-21/h3-12,16,25H,2,13-15H2,1H3,(H,24,28)(H,26,27) |
| InChIKey | YBIOKYYWKNQIBH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |