C17H20N2O5S — CID 7806952
[2-(dimethylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7806952) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7806952 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | CN(C)C(=O)COC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H20N2O5S/c1-19(2)16(20)12-24-17(21)9-10-18-25(22,23)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11,18H,9-10,12H2,1-2H3 |
| InChIKey | JXGXKOJTNBDNTL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |