C21H22N2O6S — CID 31436406
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 31436406) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 31436406 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | CN(Cc1ccco1)C(=O)COC(=O)CCNS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H22N2O6S/c1-23(14-18-7-4-12-28-18)20(24)15-29-21(25)10-11-22-30(26,27)19-9-8-16-5-2-3-6-17(16)13-19/h2-9,12-13,22H,10-11,14-15H2,1H3 |
| InChIKey | VZQJVNVOFBWJPK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |