C20H19NO4S — CID 7414463
benzyl 3-(naphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7414463) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is benzyl 3-(naphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | benzyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7414463 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | benzyl 3-(naphthalen-2-ylsulfonylamino)propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2ccccc2c1)OCc1ccccc1 |
| InChI | InChI=1S/C20H19NO4S/c22-20(25-15-16-6-2-1-3-7-16)12-13-21-26(23,24)19-11-10-17-8-4-5-9-18(17)14-19/h1-11,14,21H,12-13,15H2 |
| InChIKey | JGRWHTKIACWGFC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |