C18H17N3O6S — CID 154361009
benzyl 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]propanoate (PubChem CID 154361009) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is benzyl 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]propanoate.
| Compound Name | benzyl 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 154361009 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | benzyl 3-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)OCc1ccccc1 |
| InChI | InChI=1S/C18H17N3O6S/c22-16(27-11-12-4-2-1-3-5-12)8-9-19-28(25,26)13-6-7-14-15(10-13)21-18(24)17(23)20-14/h1-7,10,19H,8-9,11H2,(H,20,23)(H,21,24) |
| InChIKey | HWBXNIHUMIHSEQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 138.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|