C10H9N3O6S — CID 2064173
2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetic acid (PubChem CID 2064173) has the molecular formula C10H9N3O6S and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetic acid.
| Compound Name | 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 2064173 |
| Molecular Formula | C10H9N3O6S |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C10H9N3O6S/c14-8(15)4-11-20(18,19)5-1-2-6-7(3-5)13-10(17)9(16)12-6/h1-3,11H,4H2,(H,12,16)(H,13,17)(H,14,15) |
| InChIKey | GKZUIFYTNMKFAF-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|