C14H17N3O6S — CID 2206886
(2S)-2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 2206886) has the molecular formula C14H17N3O6S and a molecular weight of 355.37 g/mol. Its IUPAC name is (2S)-2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 2206886 |
| Molecular Formula | C14H17N3O6S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | (2S)-2-[(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccc2[nH]c(=O)c(=O)[nH]c2c1)C(=O)O |
| InChI | InChI=1S/C14H17N3O6S/c1-7(2)5-11(14(20)21)17-24(22,23)8-3-4-9-10(6-8)16-13(19)12(18)15-9/h3-4,6-7,11,17H,5H2,1-2H3,(H,15,18)(H,16,19)(H,20,21)/t11-/m0/s1 |
| InChIKey | NXESQNUJANVCGE-NSHDSACASA-N |
| XLogP | -0.01 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|