C15H23NO4S — CID 61155878
(2S)-4-methyl-2-[(4-propan-2-ylphenyl)sulfonylamino]pentanoic acid (PubChem CID 61155878) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(4-propan-2-ylphenyl)sulfonylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(4-propan-2-ylphenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 61155878 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (2S)-4-methyl-2-[(4-propan-2-ylphenyl)sulfonylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccc(C(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C15H23NO4S/c1-10(2)9-14(15(17)18)16-21(19,20)13-7-5-12(6-8-13)11(3)4/h5-8,10-11,14,16H,9H2,1-4H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | ICWFNCXQKKIJBV-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |