C18H28N2O8S2 — CID 24761708
2-[[2-[(1-carboxy-3-methylbutyl)sulfamoyl]phenyl]sulfonylamino]-4-methylpentanoic acid (PubChem CID 24761708) has the molecular formula C18H28N2O8S2 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[[2-[(1-carboxy-3-methylbutyl)sulfamoyl]phenyl]sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[(1-carboxy-3-methylbutyl)sulfamoyl]phenyl]sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 24761708 |
| Molecular Formula | C18H28N2O8S2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 2-[[2-[(1-carboxy-3-methylbutyl)sulfamoyl]phenyl]sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NS(=O)(=O)c1ccccc1S(=O)(=O)NC(CC(C)C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H28N2O8S2/c1-11(2)9-13(17(21)22)19-29(25,26)15-7-5-6-8-16(15)30(27,28)20-14(18(23)24)10-12(3)4/h5-8,11-14,19-20H,9-10H2,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | GCTBLAXQLHDUDZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |