C12H15Br2NO4S — CID 28828956
(2R)-2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 28828956) has the molecular formula C12H15Br2NO4S and a molecular weight of 429.13 g/mol. Its IUPAC name is (2R)-2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 28828956 |
| Molecular Formula | C12H15Br2NO4S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | (2R)-2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NS(=O)(=O)c1cc(Br)ccc1Br)C(=O)O |
| InChI | InChI=1S/C12H15Br2NO4S/c1-7(2)5-10(12(16)17)15-20(18,19)11-6-8(13)3-4-9(11)14/h3-4,6-7,10,15H,5H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | APUZZAPFBWJBBN-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |