C13H17Br2NO4S — CID 24867958
methyl 2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoate (PubChem CID 24867958) has the molecular formula C13H17Br2NO4S and a molecular weight of 443.16 g/mol. Its IUPAC name is methyl 2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 24867958 |
| Molecular Formula | C13H17Br2NO4S |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 440.92 |
| IUPAC Name | methyl 2-[(2,5-dibromophenyl)sulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H17Br2NO4S/c1-8(2)6-11(13(17)20-3)16-21(18,19)12-7-9(14)4-5-10(12)15/h4-5,7-8,11,16H,6H2,1-3H3 |
| InChIKey | OMHFXPLTUPGVFE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |