C12H16BrClN2O4S — CID 61060736
methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-4-methylpentanoate (PubChem CID 61060736) has the molecular formula C12H16BrClN2O4S and a molecular weight of 399.69 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 61060736 |
| Molecular Formula | C12H16BrClN2O4S |
| Molecular Weight | 399.69 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | methyl 2-[(5-bromo-2-chloro-3-pyridinyl)sulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C12H16BrClN2O4S/c1-7(2)4-9(12(17)20-3)16-21(18,19)10-5-8(13)6-15-11(10)14/h5-7,9,16H,4H2,1-3H3 |
| InChIKey | CGEVYSPJXDDONU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.69 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|