C14H20BrNO4S — CID 65480621
methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]-4-methylpentanoate (PubChem CID 65480621) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 65480621 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NS(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H20BrNO4S/c1-10(2)8-13(14(17)20-3)16-21(18,19)12-6-4-11(9-15)5-7-12/h4-7,10,13,16H,8-9H2,1-3H3 |
| InChIKey | SCFXAICRTTZYLB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|