C11H14BrNO4S — CID 65480230
methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]propanoate (PubChem CID 65480230) has the molecular formula C11H14BrNO4S and a molecular weight of 336.21 g/mol. Its IUPAC name is methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]propanoate.
| Compound Name | methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 65480230 |
| Molecular Formula | C11H14BrNO4S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | methyl 2-[[4-(bromomethyl)phenyl]sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)NS(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C11H14BrNO4S/c1-8(11(14)17-2)13-18(15,16)10-5-3-9(7-12)4-6-10/h3-6,8,13H,7H2,1-2H3 |
| InChIKey | KJUNNTUASJLYBI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|