C12H15NO7S — CID 60780474
2-methoxy-5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoic acid (PubChem CID 60780474) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is 2-methoxy-5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-methoxy-5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 60780474 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-methoxy-5-[(1-methoxy-1-oxopropan-2-yl)sulfamoyl]benzoic acid |
| SMILES | COC(=O)C(C)NS(=O)(=O)c1ccc(OC)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H15NO7S/c1-7(12(16)20-3)13-21(17,18)8-4-5-10(19-2)9(6-8)11(14)15/h4-7,13H,1-3H3,(H,14,15) |
| InChIKey | PFZNMUPHPVWYBA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |