C11H16N2O6S — CID 65314128
5-(1,3-dihydroxypropan-2-ylsulfamoyl)-2-methoxybenzamide (PubChem CID 65314128) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 5-(1,3-dihydroxypropan-2-ylsulfamoyl)-2-methoxybenzamide.
| Compound Name | 5-(1,3-dihydroxypropan-2-ylsulfamoyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 65314128 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 5-(1,3-dihydroxypropan-2-ylsulfamoyl)-2-methoxybenzamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CO)CO)cc1C(N)=O |
| InChI | InChI=1S/C11H16N2O6S/c1-19-10-3-2-8(4-9(10)11(12)16)20(17,18)13-7(5-14)6-15/h2-4,7,13-15H,5-6H2,1H3,(H2,12,16) |
| InChIKey | XLPZGQUGMUWXSF-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |