C10H14N2O7S — CID 65314295
N-(1,3-dihydroxypropan-2-yl)-4-methoxy-3-nitrobenzenesulfonamide (PubChem CID 65314295) has the molecular formula C10H14N2O7S and a molecular weight of 306.30 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-4-methoxy-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 65314295 |
| Molecular Formula | C10H14N2O7S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-4-methoxy-3-nitrobenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CO)CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14N2O7S/c1-19-10-3-2-8(4-9(10)12(15)16)20(17,18)11-7(5-13)6-14/h2-4,7,11,13-14H,5-6H2,1H3 |
| InChIKey | SBGOHIUUPJDGQH-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|