C10H13ClN2O5S — CID 113498887
4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-3-nitrobenzenesulfonamide (PubChem CID 113498887) has the molecular formula C10H13ClN2O5S and a molecular weight of 308.74 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 113498887 |
| Molecular Formula | C10H13ClN2O5S |
| Molecular Weight | 308.74 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-chloro-N-[(2R)-1-hydroxybutan-2-yl]-3-nitrobenzenesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13ClN2O5S/c1-2-7(6-14)12-19(17,18)8-3-4-9(11)10(5-8)13(15)16/h3-5,7,12,14H,2,6H2,1H3/t7-/m1/s1 |
| InChIKey | SGPHGAXEKOXTED-SSDOTTSWSA-N |
| XLogP | 1.30 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.74 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|