C11H15FN2O5S — CID 105061075
4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-3-methyl-5-nitrobenzenesulfonamide (PubChem CID 105061075) has the molecular formula C11H15FN2O5S and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-3-methyl-5-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-3-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 105061075 |
| Molecular Formula | C11H15FN2O5S |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-fluoro-N-[(2S)-1-hydroxybutan-2-yl]-3-methyl-5-nitrobenzenesulfonamide |
| SMILES | CC[C@@H](CO)NS(=O)(=O)c1cc(C)c(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15FN2O5S/c1-3-8(6-15)13-20(18,19)9-4-7(2)11(12)10(5-9)14(16)17/h4-5,8,13,15H,3,6H2,1-2H3/t8-/m0/s1 |
| InChIKey | GGSXRBNOLLLJDR-QMMMGPOBSA-N |
| XLogP | 1.09 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|