C10H14FN3O4S — CID 115421926
N-(3-aminopropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide (PubChem CID 115421926) has the molecular formula C10H14FN3O4S and a molecular weight of 291.30 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 115421926 |
| Molecular Formula | C10H14FN3O4S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | N-(3-aminopropyl)-4-fluoro-3-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCN)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H14FN3O4S/c1-7-5-8(6-9(10(7)11)14(15)16)19(17,18)13-4-2-3-12/h5-6,13H,2-4,12H2,1H3 |
| InChIKey | UAKXWDWOAFKTKU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|