C11H15IN2O4S — CID 114189123
N-(3-iodopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 114189123) has the molecular formula C11H15IN2O4S and a molecular weight of 398.22 g/mol. Its IUPAC name is N-(3-iodopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3-iodopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 114189123 |
| Molecular Formula | C11H15IN2O4S |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | N-(3-iodopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCI)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H15IN2O4S/c1-8-6-10(7-11(9(8)2)14(15)16)19(17,18)13-5-3-4-12/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | XIINWHMMJXVULR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|