C12H15N3O4S — CID 62667028
N-(3-cyanopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 62667028) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(3-cyanopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(3-cyanopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62667028 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(3-cyanopropyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCCC#N)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C12H15N3O4S/c1-9-7-11(8-12(10(9)2)15(16)17)20(18,19)14-6-4-3-5-13/h7-8,14H,3-4,6H2,1-2H3 |
| InChIKey | ZSRBYIXPJPXCKR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|