C11H16N2O5S — CID 7574341
N-(2-methoxyethyl)-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 7574341) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 7574341 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-(2-methoxyethyl)-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8-6-10(7-11(9(8)2)13(14)15)19(16,17)12-4-5-18-3/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | HWUUULAGZUYTIJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|