C10H14N2O5S — CID 60700382
N-ethoxy-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 60700382) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is N-ethoxy-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-ethoxy-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60700382 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | N-ethoxy-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCONS(=O)(=O)c1cc(C)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N2O5S/c1-4-17-11-18(15,16)9-5-7(2)8(3)10(6-9)12(13)14/h5-6,11H,4H2,1-3H3 |
| InChIKey | RRYSZUBPODAVLM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|