C9H8F4N2O5S — CID 107856720
4-fluoro-3-methyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 107856720) has the molecular formula C9H8F4N2O5S and a molecular weight of 332.23 g/mol. Its IUPAC name is 4-fluoro-3-methyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 107856720 |
| Molecular Formula | C9H8F4N2O5S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 4-fluoro-3-methyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NOCC(F)(F)F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C9H8F4N2O5S/c1-5-2-6(3-7(8(5)10)15(16)17)21(18,19)14-20-4-9(11,12)13/h2-3,14H,4H2,1H3 |
| InChIKey | WTMXOIJOSBDIHQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|