C10H11F3N2O5S — CID 82715012
2,3-dimethyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 82715012) has the molecular formula C10H11F3N2O5S and a molecular weight of 328.27 g/mol. Its IUPAC name is 2,3-dimethyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 2,3-dimethyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82715012 |
| Molecular Formula | C10H11F3N2O5S |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2,3-dimethyl-5-nitro-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)NOCC(F)(F)F)c1C |
| InChI | InChI=1S/C10H11F3N2O5S/c1-6-3-8(15(16)17)4-9(7(6)2)21(18,19)14-20-5-10(11,12)13/h3-4,14H,5H2,1-2H3 |
| InChIKey | VYYJUOJWALZXTJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|