C9H9ClF3NO3S — CID 82715590
4-chloro-2-methyl-N-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 82715590) has the molecular formula C9H9ClF3NO3S and a molecular weight of 303.69 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 4-chloro-2-methyl-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82715590 |
| Molecular Formula | C9H9ClF3NO3S |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 4-chloro-2-methyl-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C9H9ClF3NO3S/c1-6-4-7(10)2-3-8(6)18(15,16)14-17-5-9(11,12)13/h2-4,14H,5H2,1H3 |
| InChIKey | PIKGWHSMPDHOBH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|