C9H10F3NO4S — CID 82715039
2-methoxy-N-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 82715039) has the molecular formula C9H10F3NO4S and a molecular weight of 285.24 g/mol. Its IUPAC name is 2-methoxy-N-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 2-methoxy-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 82715039 |
| Molecular Formula | C9H10F3NO4S |
| Molecular Weight | 285.24 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-methoxy-N-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO4S/c1-16-7-4-2-3-5-8(7)18(14,15)13-17-6-9(10,11)12/h2-5,13H,6H2,1H3 |
| InChIKey | PUUZXQCEVRCUQE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.24 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|