C8H8F3NO4S — CID 60713586
N-methoxy-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 60713586) has the molecular formula C8H8F3NO4S and a molecular weight of 271.22 g/mol. Its IUPAC name is N-methoxy-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-methoxy-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 60713586 |
| Molecular Formula | C8H8F3NO4S |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | N-methoxy-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CONS(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C8H8F3NO4S/c1-15-12-17(13,14)7-5-3-2-4-6(7)16-8(9,10)11/h2-5,12H,1H3 |
| InChIKey | RZNVWGRXJKFHSQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|