C18H19F4NO3S — CID 169074985
N-(3-tert-butyl-2-fluoro-4-methylphenyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 169074985) has the molecular formula C18H19F4NO3S and a molecular weight of 405.41 g/mol. Its IUPAC name is N-(3-tert-butyl-2-fluoro-4-methylphenyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(3-tert-butyl-2-fluoro-4-methylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 169074985 |
| Molecular Formula | C18H19F4NO3S |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | N-(3-tert-butyl-2-fluoro-4-methylphenyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccccc2OC(F)(F)F)c(F)c1C(C)(C)C |
| InChI | InChI=1S/C18H19F4NO3S/c1-11-9-10-12(16(19)15(11)17(2,3)4)23-27(24,25)14-8-6-5-7-13(14)26-18(20,21)22/h5-10,23H,1-4H3 |
| InChIKey | AGJOCXDEIARIKR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |