C7H4F3NaO4S — CID 112705039
sodium 2-(trifluoromethoxy)benzenesulfonate (PubChem CID 112705039) has the molecular formula C7H4F3NaO4S and a molecular weight of 264.16 g/mol. Its IUPAC name is sodium 2-(trifluoromethoxy)benzenesulfonate.
| Compound Name | sodium 2-(trifluoromethoxy)benzenesulfonate |
|---|---|
| PubChem CID | 112705039 |
| Molecular Formula | C7H4F3NaO4S |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | sodium 2-(trifluoromethoxy)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1OC(F)(F)F.[Na+] |
| InChI | InChI=1S/C7H5F3O4S.Na/c8-7(9,10)14-5-3-1-2-4-6(5)15(11,12)13;/h1-4H,(H,11,12,13);/q;+1/p-1 |
| InChIKey | OZZADTFCWHOVGK-UHFFFAOYSA-M |
| XLogP | -1.51 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|