C13H16F3NO4S — CID 51936673
(2S,5R)-2,5-dimethyl-4-[2-(trifluoromethoxy)phenyl]sulfonylmorpholine (PubChem CID 51936673) has the molecular formula C13H16F3NO4S and a molecular weight of 339.34 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-4-[2-(trifluoromethoxy)phenyl]sulfonylmorpholine.
| Compound Name | (2S,5R)-2,5-dimethyl-4-[2-(trifluoromethoxy)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 51936673 |
| Molecular Formula | C13H16F3NO4S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-4-[2-(trifluoromethoxy)phenyl]sulfonylmorpholine |
| SMILES | C[C@@H]1CO[C@@H](C)CN1S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO4S/c1-9-8-20-10(2)7-17(9)22(18,19)12-6-4-3-5-11(12)21-13(14,15)16/h3-6,9-10H,7-8H2,1-2H3/t9-,10+/m1/s1 |
| InChIKey | GYTVQXBOOVUQPU-ZJUUUORDSA-N |
| XLogP | 2.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |