C13H17NO5S — CID 43421867
4-(2,5-dimethylmorpholin-4-yl)sulfonylbenzoic acid (PubChem CID 43421867) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)sulfonylbenzoic acid.
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 43421867 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)sulfonylbenzoic acid |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)O)cc2)C(C)CO1 |
| InChI | InChI=1S/C13H17NO5S/c1-9-8-19-10(2)7-14(9)20(17,18)12-5-3-11(4-6-12)13(15)16/h3-6,9-10H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | ICLLUJWWLJPHHK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |