C13H15ClN2O3S — CID 47304224
2-chloro-5-(2,5-dimethylmorpholin-4-yl)sulfonylbenzonitrile (PubChem CID 47304224) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylmorpholin-4-yl)sulfonylbenzonitrile.
| Compound Name | 2-chloro-5-(2,5-dimethylmorpholin-4-yl)sulfonylbenzonitrile |
|---|---|
| PubChem CID | 47304224 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylmorpholin-4-yl)sulfonylbenzonitrile |
| SMILES | CC1CN(S(=O)(=O)c2ccc(Cl)c(C#N)c2)C(C)CO1 |
| InChI | InChI=1S/C13H15ClN2O3S/c1-9-8-19-10(2)7-16(9)20(17,18)12-3-4-13(14)11(5-12)6-15/h3-5,9-10H,7-8H2,1-2H3 |
| InChIKey | VIQYYHWTFAEEQW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |