C13H17N5O3S — CID 49239732
2,5-dimethyl-4-[4-(tetrazol-1-yl)phenyl]sulfonylmorpholine (PubChem CID 49239732) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 2,5-dimethyl-4-[4-(tetrazol-1-yl)phenyl]sulfonylmorpholine.
| Compound Name | 2,5-dimethyl-4-[4-(tetrazol-1-yl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 49239732 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2,5-dimethyl-4-[4-(tetrazol-1-yl)phenyl]sulfonylmorpholine |
| SMILES | CC1CN(S(=O)(=O)c2ccc(-n3cnnn3)cc2)C(C)CO1 |
| InChI | InChI=1S/C13H17N5O3S/c1-10-8-21-11(2)7-18(10)22(19,20)13-5-3-12(4-6-13)17-9-14-15-16-17/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | TWUGXEWSVDWEHF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |