C13H17N5O2S — CID 3173758
2-methyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine (PubChem CID 3173758) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-methyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine.
| Compound Name | 2-methyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 3173758 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-methyl-1-[4-(tetrazol-1-yl)phenyl]sulfonylpiperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C13H17N5O2S/c1-11-4-2-3-9-18(11)21(19,20)13-7-5-12(6-8-13)17-10-14-15-16-17/h5-8,10-11H,2-4,9H2,1H3 |
| InChIKey | VWYVPQIJDQMUQU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |