C20H20N2O4S — CID 71654095
2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]isoindole-1,3-dione (PubChem CID 71654095) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71654095 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]isoindole-1,3-dione |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H20N2O4S/c1-14-6-4-5-13-21(14)27(25,26)16-11-9-15(10-12-16)22-19(23)17-7-2-3-8-18(17)20(22)24/h2-3,7-12,14H,4-6,13H2,1H3 |
| InChIKey | VGFCMULUCZSZNU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|