C20H19NO4S — CID 3801619
2-(2-methylpiperidin-1-yl)sulfonylanthracene-9,10-dione (PubChem CID 3801619) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is 2-(2-methylpiperidin-1-yl)sulfonylanthracene-9,10-dione.
| Compound Name | 2-(2-methylpiperidin-1-yl)sulfonylanthracene-9,10-dione |
|---|---|
| PubChem CID | 3801619 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(2-methylpiperidin-1-yl)sulfonylanthracene-9,10-dione |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H19NO4S/c1-13-6-4-5-11-21(13)26(24,25)14-9-10-17-18(12-14)20(23)16-8-3-2-7-15(16)19(17)22/h2-3,7-10,12-13H,4-6,11H2,1H3 |
| InChIKey | DVOPKQKWAHUVJR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|